Pancuronium Bromide

Temporary paralysis of skeletal muscle is the intended effect of pancuronium bromide, used during surgery and to facilitate mechanical ventilation. The agent acts at the neuromuscular junction, blocking transmission between motor nerve and muscle fibre so that contraction cannot occur; consciousness and sensation are unaffected, which is why it is given only alongside anaesthesia and sedation. Because ventilation itself depends on skeletal muscle, use is restricted to settings where the airway is controlled and respiration supported. The bromide salt carries the therapeutic properties of pancuronium without modification. Chemically the salt is C35H60Br2N2O4 with a mass near 732.7 g/mol, approved and developed through the final clinical phase.

SMILES

CC(=O)O[C@H]1C[C@@H]2CC[C@@H]3[C@H](CC[C@@]4(C)[C@H]3C[C@H]([N+]3(C)CCCCC3)[C@@H]4OC(C)=O)[C@@]2(C)C[C@@H]1[N+]1(C)CCCCC1.[Br-].[Br-]

InChI

InChI=1S/C35H60N2O4.2BrH/c1-24(38)40-32-21-26-13-14-27-28(35(26,4)23-31(32)37(6)19-11-8-12-20-37)15-16-34(3)29(27)22-30(33(34)41-25(2)39)36(5)17-9-7-10-18-36;;/h26-33H,7-23H2,1-6H3;2*1H/q+2;;/p-2/t26-,27+,28-,29-,30-,31-,32-,33-,34-,35-;;/m0../s1